C19H30N4O3S — CID 51159076
3-[5-(diethylsulfamoyl)-1-methylbenzimidazol-2-yl]-N-(2-methylpropyl)propanamide (PubChem CID 51159076) has the molecular formula C19H30N4O3S and a molecular weight of 394.54 g/mol. Its IUPAC name is 3-[5-(diethylsulfamoyl)-1-methylbenzimidazol-2-yl]-N-(2-methylpropyl)propanamide.
| Compound Name | 3-[5-(diethylsulfamoyl)-1-methylbenzimidazol-2-yl]-N-(2-methylpropyl)propanamide |
|---|---|
| PubChem CID | 51159076 |
| Molecular Formula | C19H30N4O3S |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 3-[5-(diethylsulfamoyl)-1-methylbenzimidazol-2-yl]-N-(2-methylpropyl)propanamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2c(c1)nc(CCC(=O)NCC(C)C)n2C |
| InChI | InChI=1S/C19H30N4O3S/c1-6-23(7-2)27(25,26)15-8-9-17-16(12-15)21-18(22(17)5)10-11-19(24)20-13-14(3)4/h8-9,12,14H,6-7,10-11,13H2,1-5H3,(H,20,24) |
| InChIKey | CKWFIAFZMDQDGW-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |