C11H13BrN2O6S — CID 35507607
ethyl 3-bromo-4-[(methoxycarbonylamino)sulfamoyl]benzoate (PubChem CID 35507607) has the molecular formula C11H13BrN2O6S and a molecular weight of 381.20 g/mol. Its IUPAC name is ethyl 3-bromo-4-[(methoxycarbonylamino)sulfamoyl]benzoate.
| Compound Name | ethyl 3-bromo-4-[(methoxycarbonylamino)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 35507607 |
| Molecular Formula | C11H13BrN2O6S |
| Molecular Weight | 381.20 g/mol |
| Exact Mass | 379.97 |
| IUPAC Name | ethyl 3-bromo-4-[(methoxycarbonylamino)sulfamoyl]benzoate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)NNC(=O)OC)c(Br)c1 |
| InChI | InChI=1S/C11H13BrN2O6S/c1-3-20-10(15)7-4-5-9(8(12)6-7)21(17,18)14-13-11(16)19-2/h4-6,14H,3H2,1-2H3,(H,13,16) |
| InChIKey | OIIDZESACDLQKP-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.20 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|