C17H16BrFN2O5S — CID 35536346
ethyl 4-[(3-acetamido-4-fluorophenyl)sulfamoyl]-3-bromobenzoate (PubChem CID 35536346) has the molecular formula C17H16BrFN2O5S and a molecular weight of 459.29 g/mol. Its IUPAC name is ethyl 4-[(3-acetamido-4-fluorophenyl)sulfamoyl]-3-bromobenzoate.
| Compound Name | ethyl 4-[(3-acetamido-4-fluorophenyl)sulfamoyl]-3-bromobenzoate |
|---|---|
| PubChem CID | 35536346 |
| Molecular Formula | C17H16BrFN2O5S |
| Molecular Weight | 459.29 g/mol |
| Exact Mass | 457.99 |
| IUPAC Name | ethyl 4-[(3-acetamido-4-fluorophenyl)sulfamoyl]-3-bromobenzoate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)Nc2ccc(F)c(NC(C)=O)c2)c(Br)c1 |
| InChI | InChI=1S/C17H16BrFN2O5S/c1-3-26-17(23)11-4-7-16(13(18)8-11)27(24,25)21-12-5-6-14(19)15(9-12)20-10(2)22/h4-9,21H,3H2,1-2H3,(H,20,22) |
| InChIKey | AIWHSEZURNWYSK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.29 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |