C16H14BrFN2O5S — CID 55573067
ethyl 3-bromo-4-[[(4-fluorobenzoyl)amino]sulfamoyl]benzoate (PubChem CID 55573067) has the molecular formula C16H14BrFN2O5S and a molecular weight of 445.27 g/mol. Its IUPAC name is ethyl 3-bromo-4-[[(4-fluorobenzoyl)amino]sulfamoyl]benzoate.
| Compound Name | ethyl 3-bromo-4-[[(4-fluorobenzoyl)amino]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 55573067 |
| Molecular Formula | C16H14BrFN2O5S |
| Molecular Weight | 445.27 g/mol |
| Exact Mass | 443.98 |
| IUPAC Name | ethyl 3-bromo-4-[[(4-fluorobenzoyl)amino]sulfamoyl]benzoate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)NNC(=O)c2ccc(F)cc2)c(Br)c1 |
| InChI | InChI=1S/C16H14BrFN2O5S/c1-2-25-16(22)11-5-8-14(13(17)9-11)26(23,24)20-19-15(21)10-3-6-12(18)7-4-10/h3-9,20H,2H2,1H3,(H,19,21) |
| InChIKey | RAYLEFLTASLTAU-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|