C20H23BrN2O5S — CID 39869856
ethyl 4-[[2-[[acetyl(ethyl)amino]methyl]phenyl]sulfamoyl]-3-bromobenzoate (PubChem CID 39869856) has the molecular formula C20H23BrN2O5S and a molecular weight of 483.38 g/mol. Its IUPAC name is ethyl 4-[[2-[[acetyl(ethyl)amino]methyl]phenyl]sulfamoyl]-3-bromobenzoate.
| Compound Name | ethyl 4-[[2-[[acetyl(ethyl)amino]methyl]phenyl]sulfamoyl]-3-bromobenzoate |
|---|---|
| PubChem CID | 39869856 |
| Molecular Formula | C20H23BrN2O5S |
| Molecular Weight | 483.38 g/mol |
| Exact Mass | 482.05 |
| IUPAC Name | ethyl 4-[[2-[[acetyl(ethyl)amino]methyl]phenyl]sulfamoyl]-3-bromobenzoate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)Nc2ccccc2CN(CC)C(C)=O)c(Br)c1 |
| InChI | InChI=1S/C20H23BrN2O5S/c1-4-23(14(3)24)13-16-8-6-7-9-18(16)22-29(26,27)19-11-10-15(12-17(19)21)20(25)28-5-2/h6-12,22H,4-5,13H2,1-3H3 |
| InChIKey | CCRIWUQLEVINKT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |