C19H17FN2O4S — CID 86839542
N'-(4-ethoxynaphthalen-1-yl)sulfonyl-4-fluorobenzohydrazide (PubChem CID 86839542) has the molecular formula C19H17FN2O4S and a molecular weight of 388.42 g/mol. Its IUPAC name is N'-(4-ethoxynaphthalen-1-yl)sulfonyl-4-fluorobenzohydrazide.
| Compound Name | N'-(4-ethoxynaphthalen-1-yl)sulfonyl-4-fluorobenzohydrazide |
|---|---|
| PubChem CID | 86839542 |
| Molecular Formula | C19H17FN2O4S |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | N'-(4-ethoxynaphthalen-1-yl)sulfonyl-4-fluorobenzohydrazide |
| SMILES | CCOc1ccc(S(=O)(=O)NNC(=O)c2ccc(F)cc2)c2ccccc12 |
| InChI | InChI=1S/C19H17FN2O4S/c1-2-26-17-11-12-18(16-6-4-3-5-15(16)17)27(24,25)22-21-19(23)13-7-9-14(20)10-8-13/h3-12,22H,2H2,1H3,(H,21,23) |
| InChIKey | BXJNWQSOQCLTGJ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|