C16H22N2O3S — CID 120583247
N-(4-aminobutyl)-4-ethoxynaphthalene-1-sulfonamide (PubChem CID 120583247) has the molecular formula C16H22N2O3S and a molecular weight of 322.43 g/mol. Its IUPAC name is N-(4-aminobutyl)-4-ethoxynaphthalene-1-sulfonamide.
| Compound Name | N-(4-aminobutyl)-4-ethoxynaphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 120583247 |
| Molecular Formula | C16H22N2O3S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | N-(4-aminobutyl)-4-ethoxynaphthalene-1-sulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)NCCCCN)c2ccccc12 |
| InChI | InChI=1S/C16H22N2O3S/c1-2-21-15-9-10-16(14-8-4-3-7-13(14)15)22(19,20)18-12-6-5-11-17/h3-4,7-10,18H,2,5-6,11-12,17H2,1H3 |
| InChIKey | PZJDGYOWYHNUNT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|