C24H31NO3S — CID 3605939
N-[2-(1-adamantyl)ethyl]-4-ethoxynaphthalene-1-sulfonamide (PubChem CID 3605939) has the molecular formula C24H31NO3S and a molecular weight of 413.58 g/mol. Its IUPAC name is N-[2-(1-adamantyl)ethyl]-4-ethoxynaphthalene-1-sulfonamide.
| Compound Name | N-[2-(1-adamantyl)ethyl]-4-ethoxynaphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 3605939 |
| Molecular Formula | C24H31NO3S |
| Molecular Weight | 413.58 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | N-[2-(1-adamantyl)ethyl]-4-ethoxynaphthalene-1-sulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)NCCC23CC4CC(CC(C4)C2)C3)c2ccccc12 |
| InChI | InChI=1S/C24H31NO3S/c1-2-28-22-7-8-23(21-6-4-3-5-20(21)22)29(26,27)25-10-9-24-14-17-11-18(15-24)13-19(12-17)16-24/h3-8,17-19,25H,2,9-16H2,1H3 |
| InChIKey | QLDZZDWOIYBLLC-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.58 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |