C18H25ClN2O3S — CID 119968708
4-ethoxy-N-(piperidin-3-ylmethyl)naphthalene-1-sulfonamide;hydrochloride (PubChem CID 119968708) has the molecular formula C18H25ClN2O3S and a molecular weight of 384.93 g/mol. Its IUPAC name is 4-ethoxy-N-(piperidin-3-ylmethyl)naphthalene-1-sulfonamide;hydrochloride.
| Compound Name | 4-ethoxy-N-(piperidin-3-ylmethyl)naphthalene-1-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119968708 |
| Molecular Formula | C18H25ClN2O3S |
| Molecular Weight | 384.93 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 4-ethoxy-N-(piperidin-3-ylmethyl)naphthalene-1-sulfonamide;hydrochloride |
| SMILES | CCOc1ccc(S(=O)(=O)NCC2CCCNC2)c2ccccc12.Cl |
| InChI | InChI=1S/C18H24N2O3S.ClH/c1-2-23-17-9-10-18(16-8-4-3-7-15(16)17)24(21,22)20-13-14-6-5-11-19-12-14;/h3-4,7-10,14,19-20H,2,5-6,11-13H2,1H3;1H |
| InChIKey | UYMZOMJIQWKPMJ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.93 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |