C25H33NO3S — CID 170915645
N-(1-adamantyl)-4-pentoxynaphthalene-1-sulfonamide (PubChem CID 170915645) has the molecular formula C25H33NO3S and a molecular weight of 427.61 g/mol. Its IUPAC name is N-(1-adamantyl)-4-pentoxynaphthalene-1-sulfonamide.
| Compound Name | N-(1-adamantyl)-4-pentoxynaphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 170915645 |
| Molecular Formula | C25H33NO3S |
| Molecular Weight | 427.61 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | N-(1-adamantyl)-4-pentoxynaphthalene-1-sulfonamide |
| SMILES | CCCCCOc1ccc(S(=O)(=O)NC23CC4CC(CC(C4)C2)C3)c2ccccc12 |
| InChI | InChI=1S/C25H33NO3S/c1-2-3-6-11-29-23-9-10-24(22-8-5-4-7-21(22)23)30(27,28)26-25-15-18-12-19(16-25)14-20(13-18)17-25/h4-5,7-10,18-20,26H,2-3,6,11-17H2,1H3 |
| InChIKey | KDLJELWGBJUNBO-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.61 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|