C19H16FNO5S — CID 155532593
5-[(4-ethoxynaphthalen-1-yl)sulfonylamino]-2-fluorobenzoic acid (PubChem CID 155532593) has the molecular formula C19H16FNO5S and a molecular weight of 389.40 g/mol. Its IUPAC name is 5-[(4-ethoxynaphthalen-1-yl)sulfonylamino]-2-fluorobenzoic acid.
| Compound Name | 5-[(4-ethoxynaphthalen-1-yl)sulfonylamino]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 155532593 |
| Molecular Formula | C19H16FNO5S |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | 5-[(4-ethoxynaphthalen-1-yl)sulfonylamino]-2-fluorobenzoic acid |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2ccc(F)c(C(=O)O)c2)c2ccccc12 |
| InChI | InChI=1S/C19H16FNO5S/c1-2-26-17-9-10-18(14-6-4-3-5-13(14)17)27(24,25)21-12-7-8-16(20)15(11-12)19(22)23/h3-11,21H,2H2,1H3,(H,22,23) |
| InChIKey | BUFLQYITZDIRLY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |