C18H15F2NO3S — CID 60579353
N-(2,5-difluorophenyl)-4-ethoxynaphthalene-1-sulfonamide (PubChem CID 60579353) has the molecular formula C18H15F2NO3S and a molecular weight of 363.39 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-4-ethoxynaphthalene-1-sulfonamide.
| Compound Name | N-(2,5-difluorophenyl)-4-ethoxynaphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 60579353 |
| Molecular Formula | C18H15F2NO3S |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | N-(2,5-difluorophenyl)-4-ethoxynaphthalene-1-sulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2cc(F)ccc2F)c2ccccc12 |
| InChI | InChI=1S/C18H15F2NO3S/c1-2-24-17-9-10-18(14-6-4-3-5-13(14)17)25(22,23)21-16-11-12(19)7-8-15(16)20/h3-11,21H,2H2,1H3 |
| InChIKey | XWWRQDHWPROWRO-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |