C22H22FNO5S — CID 155532366
2-fluoro-5-[(4-pentoxynaphthalen-1-yl)sulfonylamino]benzoic acid (PubChem CID 155532366) has the molecular formula C22H22FNO5S and a molecular weight of 431.49 g/mol. Its IUPAC name is 2-fluoro-5-[(4-pentoxynaphthalen-1-yl)sulfonylamino]benzoic acid.
| Compound Name | 2-fluoro-5-[(4-pentoxynaphthalen-1-yl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 155532366 |
| Molecular Formula | C22H22FNO5S |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | 2-fluoro-5-[(4-pentoxynaphthalen-1-yl)sulfonylamino]benzoic acid |
| SMILES | CCCCCOc1ccc(S(=O)(=O)Nc2ccc(F)c(C(=O)O)c2)c2ccccc12 |
| InChI | InChI=1S/C22H22FNO5S/c1-2-3-6-13-29-20-11-12-21(17-8-5-4-7-16(17)20)30(27,28)24-15-9-10-19(23)18(14-15)22(25)26/h4-5,7-12,14,24H,2-3,6,13H2,1H3,(H,25,26) |
| InChIKey | UNBNHHUEAAIBDO-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|