C21H27NO5S — CID 16645134
2-[(2-butoxy-5-tert-butylphenyl)sulfonylamino]benzoic acid (PubChem CID 16645134) has the molecular formula C21H27NO5S and a molecular weight of 405.52 g/mol. Its IUPAC name is 2-[(2-butoxy-5-tert-butylphenyl)sulfonylamino]benzoic acid.
| Compound Name | 2-[(2-butoxy-5-tert-butylphenyl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 16645134 |
| Molecular Formula | C21H27NO5S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 2-[(2-butoxy-5-tert-butylphenyl)sulfonylamino]benzoic acid |
| SMILES | CCCCOc1ccc(C(C)(C)C)cc1S(=O)(=O)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C21H27NO5S/c1-5-6-13-27-18-12-11-15(21(2,3)4)14-19(18)28(25,26)22-17-10-8-7-9-16(17)20(23)24/h7-12,14,22H,5-6,13H2,1-4H3,(H,23,24) |
| InChIKey | VSNKNGUZJKEGIF-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|