C24H34N2O3S — CID 16645141
1-(2-butoxy-5-tert-butylphenyl)sulfonyl-4-phenylpiperazine (PubChem CID 16645141) has the molecular formula C24H34N2O3S and a molecular weight of 430.61 g/mol. Its IUPAC name is 1-(2-butoxy-5-tert-butylphenyl)sulfonyl-4-phenylpiperazine.
| Compound Name | 1-(2-butoxy-5-tert-butylphenyl)sulfonyl-4-phenylpiperazine |
|---|---|
| PubChem CID | 16645141 |
| Molecular Formula | C24H34N2O3S |
| Molecular Weight | 430.61 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | 1-(2-butoxy-5-tert-butylphenyl)sulfonyl-4-phenylpiperazine |
| SMILES | CCCCOc1ccc(C(C)(C)C)cc1S(=O)(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C24H34N2O3S/c1-5-6-18-29-22-13-12-20(24(2,3)4)19-23(22)30(27,28)26-16-14-25(15-17-26)21-10-8-7-9-11-21/h7-13,19H,5-6,14-18H2,1-4H3 |
| InChIKey | INAWOZDTKGVVGX-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.61 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|