C24H34N2O3S — CID 91669913
1-(5-tert-butyl-2-ethoxyphenyl)sulfonyl-4-(2,3-dimethylphenyl)piperazine (PubChem CID 91669913) has the molecular formula C24H34N2O3S and a molecular weight of 430.61 g/mol. Its IUPAC name is 1-(5-tert-butyl-2-ethoxyphenyl)sulfonyl-4-(2,3-dimethylphenyl)piperazine.
| Compound Name | 1-(5-tert-butyl-2-ethoxyphenyl)sulfonyl-4-(2,3-dimethylphenyl)piperazine |
|---|---|
| PubChem CID | 91669913 |
| Molecular Formula | C24H34N2O3S |
| Molecular Weight | 430.61 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | 1-(5-tert-butyl-2-ethoxyphenyl)sulfonyl-4-(2,3-dimethylphenyl)piperazine |
| SMILES | CCOc1ccc(C(C)(C)C)cc1S(=O)(=O)N1CCN(c2cccc(C)c2C)CC1 |
| InChI | InChI=1S/C24H34N2O3S/c1-7-29-22-12-11-20(24(4,5)6)17-23(22)30(27,28)26-15-13-25(14-16-26)21-10-8-9-18(2)19(21)3/h8-12,17H,7,13-16H2,1-6H3 |
| InChIKey | XICQDWCRCOITCX-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.61 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |