C13H17ClFNO4S — CID 61022883
ethyl 2-[(3-chloro-2-fluorophenyl)sulfonyl-propan-2-ylamino]acetate (PubChem CID 61022883) has the molecular formula C13H17ClFNO4S and a molecular weight of 337.80 g/mol. Its IUPAC name is ethyl 2-[(3-chloro-2-fluorophenyl)sulfonyl-propan-2-ylamino]acetate.
| Compound Name | ethyl 2-[(3-chloro-2-fluorophenyl)sulfonyl-propan-2-ylamino]acetate |
|---|---|
| PubChem CID | 61022883 |
| Molecular Formula | C13H17ClFNO4S |
| Molecular Weight | 337.80 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | ethyl 2-[(3-chloro-2-fluorophenyl)sulfonyl-propan-2-ylamino]acetate |
| SMILES | CCOC(=O)CN(C(C)C)S(=O)(=O)c1cccc(Cl)c1F |
| InChI | InChI=1S/C13H17ClFNO4S/c1-4-20-12(17)8-16(9(2)3)21(18,19)11-7-5-6-10(14)13(11)15/h5-7,9H,4,8H2,1-3H3 |
| InChIKey | DTEONKMEEKLYEX-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.80 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |