C12H17ClN2O4S — CID 61047092
ethyl 2-[(6-chloro-3-pyridinyl)sulfonyl-propan-2-ylamino]acetate (PubChem CID 61047092) has the molecular formula C12H17ClN2O4S and a molecular weight of 320.80 g/mol. Its IUPAC name is ethyl 2-[(6-chloro-3-pyridinyl)sulfonyl-propan-2-ylamino]acetate.
| Compound Name | ethyl 2-[(6-chloro-3-pyridinyl)sulfonyl-propan-2-ylamino]acetate |
|---|---|
| PubChem CID | 61047092 |
| Molecular Formula | C12H17ClN2O4S |
| Molecular Weight | 320.80 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | ethyl 2-[(6-chloro-3-pyridinyl)sulfonyl-propan-2-ylamino]acetate |
| SMILES | CCOC(=O)CN(C(C)C)S(=O)(=O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C12H17ClN2O4S/c1-4-19-12(16)8-15(9(2)3)20(17,18)10-5-6-11(13)14-7-10/h5-7,9H,4,8H2,1-3H3 |
| InChIKey | XQPRLAZUEDFOIF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.80 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|