C26H28O5 — CID 174766499
1,2-diphenylethane-1,2-dione;4-methyl-1-phenylpentane-1,2,4-triol (PubChem CID 174766499) has the molecular formula C26H28O5 and a molecular weight of 420.51 g/mol. Its IUPAC name is 1,2-diphenylethane-1,2-dione;4-methyl-1-phenylpentane-1,2,4-triol.
| Compound Name | 1,2-diphenylethane-1,2-dione;4-methyl-1-phenylpentane-1,2,4-triol |
|---|---|
| PubChem CID | 174766499 |
| Molecular Formula | C26H28O5 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 1,2-diphenylethane-1,2-dione;4-methyl-1-phenylpentane-1,2,4-triol |
| SMILES | CC(C)(O)CC(O)C(O)c1ccccc1.O=C(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H10O2.C12H18O3/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12;1-12(2,15)8-10(13)11(14)9-6-4-3-5-7-9/h1-10H;3-7,10-11,13-15H,8H2,1-2H3 |
| InChIKey | GPEWWQLVCFYYIR-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|