About 2-hydroxypropanoyl 2-amino-3-phenylpropaneperoxoate;hydrochloride
2-hydroxypropanoyl 2-amino-3-phenylpropaneperoxoate;hydrochloride (PubChem CID 141457481) has the molecular formula C12H16ClNO5
and a molecular weight of 289.72 g/mol. Its IUPAC name is 2-hydroxypropanoyl 2-amino-3-phenylpropaneperoxoate;hydrochloride.
Molecular Properties
| Compound Name | 2-hydroxypropanoyl 2-amino-3-phenylpropaneperoxoate;hydrochloride |
| PubChem CID | 141457481 |
| Molecular Formula | C12H16ClNO5 |
| Molecular Weight | 289.72 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 2-hydroxypropanoyl 2-amino-3-phenylpropaneperoxoate;hydrochloride |
| SMILES | CC(O)C(=O)OOC(=O)C(N)Cc1ccccc1.Cl |
| InChI | InChI=1S/C12H15NO5.ClH/c1-8(14)11(15)17-18-12(16)10(13)7-9-5-3-2-4-6-9;/h2-6,8,10,14H,7,13H2,1H3;1H |
| InChIKey | MFJMMZPOCRHLNM-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.72 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxypropanoyl 2-amino-3-phenylpropaneperoxoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxypropanoyl 2-amino-3-phenylpropaneperoxoate;hydrochloride?
The IUPAC name of 2-hydroxypropanoyl 2-amino-3-phenylpropaneperoxoate;hydrochloride (CID 141457481) is 2-hydroxypropanoyl 2-amino-3-phenylpropaneperoxoate;hydrochloride.
What is the SMILES notation for 2-hydroxypropanoyl 2-amino-3-phenylpropaneperoxoate;hydrochloride?
The canonical SMILES for 2-hydroxypropanoyl 2-amino-3-phenylpropaneperoxoate;hydrochloride is CC(O)C(=O)OOC(=O)C(N)Cc1ccccc1.Cl.
What is the InChIKey of 2-hydroxypropanoyl 2-amino-3-phenylpropaneperoxoate;hydrochloride?
The InChIKey is MFJMMZPOCRHLNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO5.ClH/c1-8(14)11(15)17-18-12(16)10(13)7-9-5-3-2-4-6-9;/h2-6,8,10,14H,7,13H2,1H3;1H.
What are the key properties of 2-hydroxypropanoyl 2-amino-3-phenylpropaneperoxoate;hydrochloride?
2-hydroxypropanoyl 2-amino-3-phenylpropaneperoxoate;hydrochloride has a molecular weight of 289.72 g/mol, XLogP of 0.36, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxypropanoyl 2-amino-3-phenylpropaneperoxoate;hydrochloride is sourced from PubChem (CID 141457481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).