About ethyl 2-hydroxypropanoate;2-methoxyphenol;2-phenylethyl acetate
ethyl 2-hydroxypropanoate;2-methoxyphenol;2-phenylethyl acetate (PubChem CID 159722272) has the molecular formula C22H30O7
and a molecular weight of 406.48 g/mol. Its IUPAC name is ethyl 2-hydroxypropanoate;2-methoxyphenol;2-phenylethyl acetate.
Molecular Properties
| Compound Name | ethyl 2-hydroxypropanoate;2-methoxyphenol;2-phenylethyl acetate |
| PubChem CID | 159722272 |
| Molecular Formula | C22H30O7 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | ethyl 2-hydroxypropanoate;2-methoxyphenol;2-phenylethyl acetate |
| SMILES | CC(=O)OCCc1ccccc1.CCOC(=O)C(C)O.COc1ccccc1O |
| InChI | InChI=1S/C10H12O2.C7H8O2.C5H10O3/c1-9(11)12-8-7-10-5-3-2-4-6-10;1-9-7-5-3-2-4-6(7)8;1-3-8-5(7)4(2)6/h2-6H,7-8H2,1H3;2-5,8H,1H3;4,6H,3H2,1-2H3 |
| InChIKey | NAEOMOKURZMTAA-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 2-hydroxypropanoate;2-methoxyphenol;2-phenylethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-hydroxypropanoate;2-methoxyphenol;2-phenylethyl acetate?
The IUPAC name of ethyl 2-hydroxypropanoate;2-methoxyphenol;2-phenylethyl acetate (CID 159722272) is ethyl 2-hydroxypropanoate;2-methoxyphenol;2-phenylethyl acetate.
What is the SMILES notation for ethyl 2-hydroxypropanoate;2-methoxyphenol;2-phenylethyl acetate?
The canonical SMILES for ethyl 2-hydroxypropanoate;2-methoxyphenol;2-phenylethyl acetate is CC(=O)OCCc1ccccc1.CCOC(=O)C(C)O.COc1ccccc1O.
What is the InChIKey of ethyl 2-hydroxypropanoate;2-methoxyphenol;2-phenylethyl acetate?
The InChIKey is NAEOMOKURZMTAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2.C7H8O2.C5H10O3/c1-9(11)12-8-7-10-5-3-2-4-6-10;1-9-7-5-3-2-4-6(7)8;1-3-8-5(7)4(2)6/h2-6H,7-8H2,1H3;2-5,8H,1H3;4,6H,3H2,1-2H3.
What are the key properties of ethyl 2-hydroxypropanoate;2-methoxyphenol;2-phenylethyl acetate?
ethyl 2-hydroxypropanoate;2-methoxyphenol;2-phenylethyl acetate has a molecular weight of 406.48 g/mol, XLogP of 3.12, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-hydroxypropanoate;2-methoxyphenol;2-phenylethyl acetate is sourced from PubChem (CID 159722272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).