C9H18O7 — CID 89266944
ethyl 2-hydroxypropanoate;(3R)-1,3,4-trihydroxybutan-2-one (PubChem CID 89266944) has the molecular formula C9H18O7 and a molecular weight of 238.24 g/mol. Its IUPAC name is ethyl 2-hydroxypropanoate;(3R)-1,3,4-trihydroxybutan-2-one.
| Compound Name | ethyl 2-hydroxypropanoate;(3R)-1,3,4-trihydroxybutan-2-one |
|---|---|
| PubChem CID | 89266944 |
| Molecular Formula | C9H18O7 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | ethyl 2-hydroxypropanoate;(3R)-1,3,4-trihydroxybutan-2-one |
| SMILES | CCOC(=O)C(C)O.O=C(CO)[C@H](O)CO |
| InChI | InChI=1S/C5H10O3.C4H8O4/c1-3-8-5(7)4(2)6;5-1-3(7)4(8)2-6/h4,6H,3H2,1-2H3;3,5-7H,1-2H2/t;3-/m.1/s1 |
| InChIKey | ADCVAIHRLYZBDU-ZYRQIYSTSA-N |
| XLogP | -2.17 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |