C23H30BrN3O3 — CID 66811490
2-bromo-N-carbamoyl-2-ethylbutanamide;N,N-dimethyl-2,2-diphenylacetamide (PubChem CID 66811490) has the molecular formula C23H30BrN3O3 and a molecular weight of 476.42 g/mol. Its IUPAC name is 2-bromo-N-carbamoyl-2-ethylbutanamide;N,N-dimethyl-2,2-diphenylacetamide.
| Compound Name | 2-bromo-N-carbamoyl-2-ethylbutanamide;N,N-dimethyl-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 66811490 |
| Molecular Formula | C23H30BrN3O3 |
| Molecular Weight | 476.42 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | 2-bromo-N-carbamoyl-2-ethylbutanamide;N,N-dimethyl-2,2-diphenylacetamide |
| SMILES | CCC(Br)(CC)C(=O)NC(N)=O.CN(C)C(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H17NO.C7H13BrN2O2/c1-17(2)16(18)15(13-9-5-3-6-10-13)14-11-7-4-8-12-14;1-3-7(8,4-2)5(11)10-6(9)12/h3-12,15H,1-2H3;3-4H2,1-2H3,(H3,9,10,11,12) |
| InChIKey | JQNMUBPEORTIPV-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|