C30H30N2O4 — CID 157195375
(2R)-N-hydroxy-N,2-diphenylpropanamide;nitrosobenzene;2-phenylpropanal (PubChem CID 157195375) has the molecular formula C30H30N2O4 and a molecular weight of 482.58 g/mol. Its IUPAC name is (2R)-N-hydroxy-N,2-diphenylpropanamide;nitrosobenzene;2-phenylpropanal.
| Compound Name | (2R)-N-hydroxy-N,2-diphenylpropanamide;nitrosobenzene;2-phenylpropanal |
|---|---|
| PubChem CID | 157195375 |
| Molecular Formula | C30H30N2O4 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | (2R)-N-hydroxy-N,2-diphenylpropanamide;nitrosobenzene;2-phenylpropanal |
| SMILES | CC(C=O)c1ccccc1.C[C@@H](C(=O)N(O)c1ccccc1)c1ccccc1.O=Nc1ccccc1 |
| InChI | InChI=1S/C15H15NO2.C9H10O.C6H5NO/c1-12(13-8-4-2-5-9-13)15(17)16(18)14-10-6-3-7-11-14;1-8(7-10)9-5-3-2-4-6-9;8-7-6-4-2-1-3-5-6/h2-12,18H,1H3;2-8H,1H3;1-5H/t12-;;/m1../s1 |
| InChIKey | AQELBCBKMPAVAZ-CURYUGHLSA-N |
| XLogP | 7.29 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|