C26H25NO3 — CID 124640134
(2R)-4-methyl-3-oxo-2-[(1S)-2-oxo-1-phenylethyl]-N,N-diphenylpentanamide (PubChem CID 124640134) has the molecular formula C26H25NO3 and a molecular weight of 399.49 g/mol. Its IUPAC name is (2R)-4-methyl-3-oxo-2-[(1S)-2-oxo-1-phenylethyl]-N,N-diphenylpentanamide.
| Compound Name | (2R)-4-methyl-3-oxo-2-[(1S)-2-oxo-1-phenylethyl]-N,N-diphenylpentanamide |
|---|---|
| PubChem CID | 124640134 |
| Molecular Formula | C26H25NO3 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | (2R)-4-methyl-3-oxo-2-[(1S)-2-oxo-1-phenylethyl]-N,N-diphenylpentanamide |
| SMILES | CC(C)C(=O)[C@H](C(=O)N(c1ccccc1)c1ccccc1)[C@H](C=O)c1ccccc1 |
| InChI | InChI=1S/C26H25NO3/c1-19(2)25(29)24(23(18-28)20-12-6-3-7-13-20)26(30)27(21-14-8-4-9-15-21)22-16-10-5-11-17-22/h3-19,23-24H,1-2H3/t23-,24-/m1/s1 |
| InChIKey | RAYQVVAVOQVBMI-DNQXCXABSA-N |
| XLogP | 5.18 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|