About 2-phenylpropylideneurea
2-phenylpropylideneurea (PubChem CID 57051679) has the molecular formula C10H12N2O
and a molecular weight of 176.22 g/mol. Its IUPAC name is 2-phenylpropylideneurea.
Molecular Properties
| Compound Name | 2-phenylpropylideneurea |
| PubChem CID | 57051679 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 2-phenylpropylideneurea |
| SMILES | CC(C=NC(N)=O)c1ccccc1 |
| InChI | InChI=1S/C10H12N2O/c1-8(7-12-10(11)13)9-5-3-2-4-6-9/h2-8H,1H3,(H2,11,13) |
| InChIKey | DZIJUCGVWSUSEP-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylpropylideneurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylpropylideneurea?
The IUPAC name of 2-phenylpropylideneurea (CID 57051679) is 2-phenylpropylideneurea.
What is the SMILES notation for 2-phenylpropylideneurea?
The canonical SMILES for 2-phenylpropylideneurea is CC(C=NC(N)=O)c1ccccc1.
What is the InChIKey of 2-phenylpropylideneurea?
The InChIKey is DZIJUCGVWSUSEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O/c1-8(7-12-10(11)13)9-5-3-2-4-6-9/h2-8H,1H3,(H2,11,13).
What are the key properties of 2-phenylpropylideneurea?
2-phenylpropylideneurea has a molecular weight of 176.22 g/mol, XLogP of 1.94, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylpropylideneurea is sourced from PubChem (CID 57051679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).