C14H21N3O4S — CID 175222339
[[1-(methylsulfamoyl)piperidin-4-yl]-phenylmethyl] carbamate (PubChem CID 175222339) has the molecular formula C14H21N3O4S and a molecular weight of 327.41 g/mol. Its IUPAC name is [[1-(methylsulfamoyl)piperidin-4-yl]-phenylmethyl] carbamate.
| Compound Name | [[1-(methylsulfamoyl)piperidin-4-yl]-phenylmethyl] carbamate |
|---|---|
| PubChem CID | 175222339 |
| Molecular Formula | C14H21N3O4S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | [[1-(methylsulfamoyl)piperidin-4-yl]-phenylmethyl] carbamate |
| SMILES | CNS(=O)(=O)N1CCC(C(OC(N)=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C14H21N3O4S/c1-16-22(19,20)17-9-7-12(8-10-17)13(21-14(15)18)11-5-3-2-4-6-11/h2-6,12-13,16H,7-10H2,1H3,(H2,15,18) |
| InChIKey | CEOSLDQHGJEQJL-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |