C8H17N3O4S — CID 130277576
[1-(methylsulfamoyl)piperidin-4-yl]methylcarbamic acid (PubChem CID 130277576) has the molecular formula C8H17N3O4S and a molecular weight of 251.31 g/mol. Its IUPAC name is [1-(methylsulfamoyl)piperidin-4-yl]methylcarbamic acid.
| Compound Name | [1-(methylsulfamoyl)piperidin-4-yl]methylcarbamic acid |
|---|---|
| PubChem CID | 130277576 |
| Molecular Formula | C8H17N3O4S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | [1-(methylsulfamoyl)piperidin-4-yl]methylcarbamic acid |
| SMILES | CNS(=O)(=O)N1CCC(CNC(=O)O)CC1 |
| InChI | InChI=1S/C8H17N3O4S/c1-9-16(14,15)11-4-2-7(3-5-11)6-10-8(12)13/h7,9-10H,2-6H2,1H3,(H,12,13) |
| InChIKey | CYHVXLITDBFEDB-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |