C10H17N3O3S — CID 103850354
N-[[1-(cyanomethylsulfonyl)piperidin-4-yl]methyl]acetamide (PubChem CID 103850354) has the molecular formula C10H17N3O3S and a molecular weight of 259.33 g/mol. Its IUPAC name is N-[[1-(cyanomethylsulfonyl)piperidin-4-yl]methyl]acetamide.
| Compound Name | N-[[1-(cyanomethylsulfonyl)piperidin-4-yl]methyl]acetamide |
|---|---|
| PubChem CID | 103850354 |
| Molecular Formula | C10H17N3O3S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | N-[[1-(cyanomethylsulfonyl)piperidin-4-yl]methyl]acetamide |
| SMILES | CC(=O)NCC1CCN(S(=O)(=O)CC#N)CC1 |
| InChI | InChI=1S/C10H17N3O3S/c1-9(14)12-8-10-2-5-13(6-3-10)17(15,16)7-4-11/h10H,2-3,5-8H2,1H3,(H,12,14) |
| InChIKey | AWMPOCCMOKPGFG-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |