C9H14N2O2 — CID 67500694
(4-cyanocyclohexyl)methylcarbamic acid (PubChem CID 67500694) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is (4-cyanocyclohexyl)methylcarbamic acid.
| Compound Name | (4-cyanocyclohexyl)methylcarbamic acid |
|---|---|
| PubChem CID | 67500694 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | (4-cyanocyclohexyl)methylcarbamic acid |
| SMILES | N#CC1CCC(CNC(=O)O)CC1 |
| InChI | InChI=1S/C9H14N2O2/c10-5-7-1-3-8(4-2-7)6-11-9(12)13/h7-8,11H,1-4,6H2,(H,12,13) |
| InChIKey | QLMAZAOGXXNUDL-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |