C15H21FN2O4S — CID 141057193
[1-[2-(4-fluorophenyl)ethylsulfonyl]piperidin-4-yl]methylcarbamic acid (PubChem CID 141057193) has the molecular formula C15H21FN2O4S and a molecular weight of 344.41 g/mol. Its IUPAC name is [1-[2-(4-fluorophenyl)ethylsulfonyl]piperidin-4-yl]methylcarbamic acid.
| Compound Name | [1-[2-(4-fluorophenyl)ethylsulfonyl]piperidin-4-yl]methylcarbamic acid |
|---|---|
| PubChem CID | 141057193 |
| Molecular Formula | C15H21FN2O4S |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | [1-[2-(4-fluorophenyl)ethylsulfonyl]piperidin-4-yl]methylcarbamic acid |
| SMILES | O=C(O)NCC1CCN(S(=O)(=O)CCc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C15H21FN2O4S/c16-14-3-1-12(2-4-14)7-10-23(21,22)18-8-5-13(6-9-18)11-17-15(19)20/h1-4,13,17H,5-11H2,(H,19,20) |
| InChIKey | JGANUHIHAPLKSF-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |