C16H23FN2O3S — CID 110823021
N-(1-ethylsulfonylpiperidin-4-yl)-3-(4-fluorophenyl)propanamide (PubChem CID 110823021) has the molecular formula C16H23FN2O3S and a molecular weight of 342.44 g/mol. Its IUPAC name is N-(1-ethylsulfonylpiperidin-4-yl)-3-(4-fluorophenyl)propanamide.
| Compound Name | N-(1-ethylsulfonylpiperidin-4-yl)-3-(4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 110823021 |
| Molecular Formula | C16H23FN2O3S |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | N-(1-ethylsulfonylpiperidin-4-yl)-3-(4-fluorophenyl)propanamide |
| SMILES | CCS(=O)(=O)N1CCC(NC(=O)CCc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C16H23FN2O3S/c1-2-23(21,22)19-11-9-15(10-12-19)18-16(20)8-5-13-3-6-14(17)7-4-13/h3-4,6-7,15H,2,5,8-12H2,1H3,(H,18,20) |
| InChIKey | GVTSSJVOJZBAQN-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |