C26H34FN3O2 — CID 156782583
N-[1-[2-(4-fluoro-N-propanoylanilino)ethyl]piperidin-4-yl]-3-(4-methylphenyl)propanamide (PubChem CID 156782583) has the molecular formula C26H34FN3O2 and a molecular weight of 439.58 g/mol. Its IUPAC name is N-[1-[2-(4-fluoro-N-propanoylanilino)ethyl]piperidin-4-yl]-3-(4-methylphenyl)propanamide.
| Compound Name | N-[1-[2-(4-fluoro-N-propanoylanilino)ethyl]piperidin-4-yl]-3-(4-methylphenyl)propanamide |
|---|---|
| PubChem CID | 156782583 |
| Molecular Formula | C26H34FN3O2 |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | N-[1-[2-(4-fluoro-N-propanoylanilino)ethyl]piperidin-4-yl]-3-(4-methylphenyl)propanamide |
| SMILES | CCC(=O)N(CCN1CCC(NC(=O)CCc2ccc(C)cc2)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C26H34FN3O2/c1-3-26(32)30(24-11-9-22(27)10-12-24)19-18-29-16-14-23(15-17-29)28-25(31)13-8-21-6-4-20(2)5-7-21/h4-7,9-12,23H,3,8,13-19H2,1-2H3,(H,28,31) |
| InChIKey | OUJNLMVVQZYEBE-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |