C26H34FN3O2 — CID 175358904
N-(4-fluorophenyl)-N-[2-[4-(4-methyl-N-propanoylanilino)piperidin-1-yl]ethyl]propanamide (PubChem CID 175358904) has the molecular formula C26H34FN3O2 and a molecular weight of 439.58 g/mol. Its IUPAC name is N-(4-fluorophenyl)-N-[2-[4-(4-methyl-N-propanoylanilino)piperidin-1-yl]ethyl]propanamide.
| Compound Name | N-(4-fluorophenyl)-N-[2-[4-(4-methyl-N-propanoylanilino)piperidin-1-yl]ethyl]propanamide |
|---|---|
| PubChem CID | 175358904 |
| Molecular Formula | C26H34FN3O2 |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | N-(4-fluorophenyl)-N-[2-[4-(4-methyl-N-propanoylanilino)piperidin-1-yl]ethyl]propanamide |
| SMILES | CCC(=O)N(CCN1CCC(N(C(=O)CC)c2ccc(C)cc2)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C26H34FN3O2/c1-4-25(31)29(22-12-8-21(27)9-13-22)19-18-28-16-14-24(15-17-28)30(26(32)5-2)23-10-6-20(3)7-11-23/h6-13,24H,4-5,14-19H2,1-3H3 |
| InChIKey | VVCRQZLKMHDDNI-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |