C21H24ClFN2O2 — CID 46161886
N-[1-[(5-chloro-2-hydroxyphenyl)methyl]piperidin-4-yl]-N-(4-fluorophenyl)propanamide (PubChem CID 46161886) has the molecular formula C21H24ClFN2O2 and a molecular weight of 390.89 g/mol. Its IUPAC name is N-[1-[(5-chloro-2-hydroxyphenyl)methyl]piperidin-4-yl]-N-(4-fluorophenyl)propanamide.
| Compound Name | N-[1-[(5-chloro-2-hydroxyphenyl)methyl]piperidin-4-yl]-N-(4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 46161886 |
| Molecular Formula | C21H24ClFN2O2 |
| Molecular Weight | 390.89 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | N-[1-[(5-chloro-2-hydroxyphenyl)methyl]piperidin-4-yl]-N-(4-fluorophenyl)propanamide |
| SMILES | CCC(=O)N(c1ccc(F)cc1)C1CCN(Cc2cc(Cl)ccc2O)CC1 |
| InChI | InChI=1S/C21H24ClFN2O2/c1-2-21(27)25(18-6-4-17(23)5-7-18)19-9-11-24(12-10-19)14-15-13-16(22)3-8-20(15)26/h3-8,13,19,26H,2,9-12,14H2,1H3 |
| InChIKey | WGGUPIWJMJYCRO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.89 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|