C26H26ClFN2O — CID 46054475
N-[1-[(2-chlorophenyl)methyl]piperidin-4-yl]-N-(4-fluorophenyl)-3-methylbenzamide (PubChem CID 46054475) has the molecular formula C26H26ClFN2O and a molecular weight of 436.96 g/mol. Its IUPAC name is N-[1-[(2-chlorophenyl)methyl]piperidin-4-yl]-N-(4-fluorophenyl)-3-methylbenzamide.
| Compound Name | N-[1-[(2-chlorophenyl)methyl]piperidin-4-yl]-N-(4-fluorophenyl)-3-methylbenzamide |
|---|---|
| PubChem CID | 46054475 |
| Molecular Formula | C26H26ClFN2O |
| Molecular Weight | 436.96 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | N-[1-[(2-chlorophenyl)methyl]piperidin-4-yl]-N-(4-fluorophenyl)-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)N(c2ccc(F)cc2)C2CCN(Cc3ccccc3Cl)CC2)c1 |
| InChI | InChI=1S/C26H26ClFN2O/c1-19-5-4-7-20(17-19)26(31)30(23-11-9-22(28)10-12-23)24-13-15-29(16-14-24)18-21-6-2-3-8-25(21)27/h2-12,17,24H,13-16,18H2,1H3 |
| InChIKey | SSLZXIPSCLVUBP-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.96 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |