C27H29FN2O3 — CID 46048053
N-(4-fluorophenyl)-2-methoxy-N-[1-[(2-methoxyphenyl)methyl]piperidin-4-yl]benzamide (PubChem CID 46048053) has the molecular formula C27H29FN2O3 and a molecular weight of 448.54 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-methoxy-N-[1-[(2-methoxyphenyl)methyl]piperidin-4-yl]benzamide.
| Compound Name | N-(4-fluorophenyl)-2-methoxy-N-[1-[(2-methoxyphenyl)methyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 46048053 |
| Molecular Formula | C27H29FN2O3 |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | N-(4-fluorophenyl)-2-methoxy-N-[1-[(2-methoxyphenyl)methyl]piperidin-4-yl]benzamide |
| SMILES | COc1ccccc1CN1CCC(N(C(=O)c2ccccc2OC)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C27H29FN2O3/c1-32-25-9-5-3-7-20(25)19-29-17-15-23(16-18-29)30(22-13-11-21(28)12-14-22)27(31)24-8-4-6-10-26(24)33-2/h3-14,23H,15-19H2,1-2H3 |
| InChIKey | AFGSIZUDASRYTK-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |