C26H26F2N2O2 — CID 46047973
N-(4-fluorophenyl)-N-[1-[(2-fluorophenyl)methyl]piperidin-4-yl]-4-methoxybenzamide (PubChem CID 46047973) has the molecular formula C26H26F2N2O2 and a molecular weight of 436.50 g/mol. Its IUPAC name is N-(4-fluorophenyl)-N-[1-[(2-fluorophenyl)methyl]piperidin-4-yl]-4-methoxybenzamide.
| Compound Name | N-(4-fluorophenyl)-N-[1-[(2-fluorophenyl)methyl]piperidin-4-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 46047973 |
| Molecular Formula | C26H26F2N2O2 |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | N-(4-fluorophenyl)-N-[1-[(2-fluorophenyl)methyl]piperidin-4-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)N(c2ccc(F)cc2)C2CCN(Cc3ccccc3F)CC2)cc1 |
| InChI | InChI=1S/C26H26F2N2O2/c1-32-24-12-6-19(7-13-24)26(31)30(22-10-8-21(27)9-11-22)23-14-16-29(17-15-23)18-20-4-2-3-5-25(20)28/h2-13,23H,14-18H2,1H3 |
| InChIKey | FNNRBDYRQRCEJQ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |