C26H24F4N2O — CID 46055052
N-(4-fluorophenyl)-N-[1-[[2-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]benzamide (PubChem CID 46055052) has the molecular formula C26H24F4N2O and a molecular weight of 456.48 g/mol. Its IUPAC name is N-(4-fluorophenyl)-N-[1-[[2-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]benzamide.
| Compound Name | N-(4-fluorophenyl)-N-[1-[[2-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 46055052 |
| Molecular Formula | C26H24F4N2O |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | N-(4-fluorophenyl)-N-[1-[[2-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]benzamide |
| SMILES | O=C(c1ccccc1)N(c1ccc(F)cc1)C1CCN(Cc2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C26H24F4N2O/c27-21-10-12-22(13-11-21)32(25(33)19-6-2-1-3-7-19)23-14-16-31(17-15-23)18-20-8-4-5-9-24(20)26(28,29)30/h1-13,23H,14-18H2 |
| InChIKey | BMPFEVYYJULUFG-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |