C23H29FN2O — CID 42858014
4-fluoro-N-[1-(3-methylbutyl)piperidin-4-yl]-N-phenylbenzamide (PubChem CID 42858014) has the molecular formula C23H29FN2O and a molecular weight of 368.50 g/mol. Its IUPAC name is 4-fluoro-N-[1-(3-methylbutyl)piperidin-4-yl]-N-phenylbenzamide.
| Compound Name | 4-fluoro-N-[1-(3-methylbutyl)piperidin-4-yl]-N-phenylbenzamide |
|---|---|
| PubChem CID | 42858014 |
| Molecular Formula | C23H29FN2O |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | 4-fluoro-N-[1-(3-methylbutyl)piperidin-4-yl]-N-phenylbenzamide |
| SMILES | CC(C)CCN1CCC(N(C(=O)c2ccc(F)cc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C23H29FN2O/c1-18(2)12-15-25-16-13-22(14-17-25)26(21-6-4-3-5-7-21)23(27)19-8-10-20(24)11-9-19/h3-11,18,22H,12-17H2,1-2H3 |
| InChIKey | QSOKOEAMIAOMKJ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |