C27H28F2N2O — CID 46052023
N-(4-ethylphenyl)-4-fluoro-N-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]benzamide (PubChem CID 46052023) has the molecular formula C27H28F2N2O and a molecular weight of 434.53 g/mol. Its IUPAC name is N-(4-ethylphenyl)-4-fluoro-N-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]benzamide.
| Compound Name | N-(4-ethylphenyl)-4-fluoro-N-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 46052023 |
| Molecular Formula | C27H28F2N2O |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | N-(4-ethylphenyl)-4-fluoro-N-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]benzamide |
| SMILES | CCc1ccc(N(C(=O)c2ccc(F)cc2)C2CCN(Cc3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C27H28F2N2O/c1-2-20-5-13-25(14-6-20)31(27(32)22-7-11-24(29)12-8-22)26-15-17-30(18-16-26)19-21-3-9-23(28)10-4-21/h3-14,26H,2,15-19H2,1H3 |
| InChIKey | NXQWPAASRFTQTI-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |