C26H28FN3O — CID 46054943
N-(4-ethylphenyl)-4-fluoro-N-[1-(pyridin-3-ylmethyl)piperidin-4-yl]benzamide (PubChem CID 46054943) has the molecular formula C26H28FN3O and a molecular weight of 417.53 g/mol. Its IUPAC name is N-(4-ethylphenyl)-4-fluoro-N-[1-(pyridin-3-ylmethyl)piperidin-4-yl]benzamide.
| Compound Name | N-(4-ethylphenyl)-4-fluoro-N-[1-(pyridin-3-ylmethyl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 46054943 |
| Molecular Formula | C26H28FN3O |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | N-(4-ethylphenyl)-4-fluoro-N-[1-(pyridin-3-ylmethyl)piperidin-4-yl]benzamide |
| SMILES | CCc1ccc(N(C(=O)c2ccc(F)cc2)C2CCN(Cc3cccnc3)CC2)cc1 |
| InChI | InChI=1S/C26H28FN3O/c1-2-20-5-11-24(12-6-20)30(26(31)22-7-9-23(27)10-8-22)25-13-16-29(17-14-25)19-21-4-3-15-28-18-21/h3-12,15,18,25H,2,13-14,16-17,19H2,1H3 |
| InChIKey | LNGMOSYAAKZVTD-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |