C28H32FN3O2 — CID 46054747
N-[1-[[4-(dimethylamino)phenyl]methyl]piperidin-4-yl]-4-fluoro-N-(3-methoxyphenyl)benzamide (PubChem CID 46054747) has the molecular formula C28H32FN3O2 and a molecular weight of 461.58 g/mol. Its IUPAC name is N-[1-[[4-(dimethylamino)phenyl]methyl]piperidin-4-yl]-4-fluoro-N-(3-methoxyphenyl)benzamide.
| Compound Name | N-[1-[[4-(dimethylamino)phenyl]methyl]piperidin-4-yl]-4-fluoro-N-(3-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 46054747 |
| Molecular Formula | C28H32FN3O2 |
| Molecular Weight | 461.58 g/mol |
| Exact Mass | 461.25 |
| IUPAC Name | N-[1-[[4-(dimethylamino)phenyl]methyl]piperidin-4-yl]-4-fluoro-N-(3-methoxyphenyl)benzamide |
| SMILES | COc1cccc(N(C(=O)c2ccc(F)cc2)C2CCN(Cc3ccc(N(C)C)cc3)CC2)c1 |
| InChI | InChI=1S/C28H32FN3O2/c1-30(2)24-13-7-21(8-14-24)20-31-17-15-25(16-18-31)32(26-5-4-6-27(19-26)34-3)28(33)22-9-11-23(29)12-10-22/h4-14,19,25H,15-18,20H2,1-3H3 |
| InChIKey | APNTWGAWNNIHJT-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.58 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|