C28H33N3O — CID 46054292
N-[1-[[4-(dimethylamino)phenyl]methyl]piperidin-4-yl]-4-methyl-N-phenylbenzamide (PubChem CID 46054292) has the molecular formula C28H33N3O and a molecular weight of 427.59 g/mol. Its IUPAC name is N-[1-[[4-(dimethylamino)phenyl]methyl]piperidin-4-yl]-4-methyl-N-phenylbenzamide.
| Compound Name | N-[1-[[4-(dimethylamino)phenyl]methyl]piperidin-4-yl]-4-methyl-N-phenylbenzamide |
|---|---|
| PubChem CID | 46054292 |
| Molecular Formula | C28H33N3O |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | N-[1-[[4-(dimethylamino)phenyl]methyl]piperidin-4-yl]-4-methyl-N-phenylbenzamide |
| SMILES | Cc1ccc(C(=O)N(c2ccccc2)C2CCN(Cc3ccc(N(C)C)cc3)CC2)cc1 |
| InChI | InChI=1S/C28H33N3O/c1-22-9-13-24(14-10-22)28(32)31(26-7-5-4-6-8-26)27-17-19-30(20-18-27)21-23-11-15-25(16-12-23)29(2)3/h4-16,27H,17-21H2,1-3H3 |
| InChIKey | BGUYGEBLTCMUGH-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|