C16H22ClFN2O2 — CID 122043538
2-[[1-[(5-chloro-2-fluorophenyl)methyl]azepan-4-yl]-methylamino]acetic acid (PubChem CID 122043538) has the molecular formula C16H22ClFN2O2 and a molecular weight of 328.81 g/mol. Its IUPAC name is 2-[[1-[(5-chloro-2-fluorophenyl)methyl]azepan-4-yl]-methylamino]acetic acid.
| Compound Name | 2-[[1-[(5-chloro-2-fluorophenyl)methyl]azepan-4-yl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 122043538 |
| Molecular Formula | C16H22ClFN2O2 |
| Molecular Weight | 328.81 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 2-[[1-[(5-chloro-2-fluorophenyl)methyl]azepan-4-yl]-methylamino]acetic acid |
| SMILES | CN(CC(=O)O)C1CCCN(Cc2cc(Cl)ccc2F)CC1 |
| InChI | InChI=1S/C16H22ClFN2O2/c1-19(11-16(21)22)14-3-2-7-20(8-6-14)10-12-9-13(17)4-5-15(12)18/h4-5,9,14H,2-3,6-8,10-11H2,1H3,(H,21,22) |
| InChIKey | RFMOODYSVVSCDP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.81 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |