C17H25BrN2O3 — CID 122043403
2-[[1-[(2-bromo-4-methoxyphenyl)methyl]azepan-4-yl]-methylamino]acetic acid (PubChem CID 122043403) has the molecular formula C17H25BrN2O3 and a molecular weight of 385.30 g/mol. Its IUPAC name is 2-[[1-[(2-bromo-4-methoxyphenyl)methyl]azepan-4-yl]-methylamino]acetic acid.
| Compound Name | 2-[[1-[(2-bromo-4-methoxyphenyl)methyl]azepan-4-yl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 122043403 |
| Molecular Formula | C17H25BrN2O3 |
| Molecular Weight | 385.30 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 2-[[1-[(2-bromo-4-methoxyphenyl)methyl]azepan-4-yl]-methylamino]acetic acid |
| SMILES | COc1ccc(CN2CCCC(N(C)CC(=O)O)CC2)c(Br)c1 |
| InChI | InChI=1S/C17H25BrN2O3/c1-19(12-17(21)22)14-4-3-8-20(9-7-14)11-13-5-6-15(23-2)10-16(13)18/h5-6,10,14H,3-4,7-9,11-12H2,1-2H3,(H,21,22) |
| InChIKey | IVNRAFMGNJOOAN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |