C20H32N2O4 — CID 122043452
2-[[1-[(3-methoxy-2-propan-2-yloxyphenyl)methyl]azepan-4-yl]-methylamino]acetic acid (PubChem CID 122043452) has the molecular formula C20H32N2O4 and a molecular weight of 364.49 g/mol. Its IUPAC name is 2-[[1-[(3-methoxy-2-propan-2-yloxyphenyl)methyl]azepan-4-yl]-methylamino]acetic acid.
| Compound Name | 2-[[1-[(3-methoxy-2-propan-2-yloxyphenyl)methyl]azepan-4-yl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 122043452 |
| Molecular Formula | C20H32N2O4 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | 2-[[1-[(3-methoxy-2-propan-2-yloxyphenyl)methyl]azepan-4-yl]-methylamino]acetic acid |
| SMILES | COc1cccc(CN2CCCC(N(C)CC(=O)O)CC2)c1OC(C)C |
| InChI | InChI=1S/C20H32N2O4/c1-15(2)26-20-16(7-5-9-18(20)25-4)13-22-11-6-8-17(10-12-22)21(3)14-19(23)24/h5,7,9,15,17H,6,8,10-14H2,1-4H3,(H,23,24) |
| InChIKey | CIPISKIQFOIPJR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |