C24H32N2O3 — CID 165361588
N-[1-[2-(2,6-dimethoxyphenyl)ethyl]piperidin-4-yl]-N-phenylpropanamide (PubChem CID 165361588) has the molecular formula C24H32N2O3 and a molecular weight of 396.53 g/mol. Its IUPAC name is N-[1-[2-(2,6-dimethoxyphenyl)ethyl]piperidin-4-yl]-N-phenylpropanamide.
| Compound Name | N-[1-[2-(2,6-dimethoxyphenyl)ethyl]piperidin-4-yl]-N-phenylpropanamide |
|---|---|
| PubChem CID | 165361588 |
| Molecular Formula | C24H32N2O3 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | N-[1-[2-(2,6-dimethoxyphenyl)ethyl]piperidin-4-yl]-N-phenylpropanamide |
| SMILES | CCC(=O)N(c1ccccc1)C1CCN(CCc2c(OC)cccc2OC)CC1 |
| InChI | InChI=1S/C24H32N2O3/c1-4-24(27)26(19-9-6-5-7-10-19)20-13-16-25(17-14-20)18-15-21-22(28-2)11-8-12-23(21)29-3/h5-12,20H,4,13-18H2,1-3H3 |
| InChIKey | GSKXYRVXRAGXBJ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |