About N-[1-[2-(2,5-dimethoxy-4-methylsulfanylphenyl)ethyl]piperidin-4-yl]-N-phenylpropanamide
N-[1-[2-(2,5-dimethoxy-4-methylsulfanylphenyl)ethyl]piperidin-4-yl]-N-phenylpropanamide (PubChem CID 165365067) has the molecular formula C25H34N2O3S
and a molecular weight of 442.63 g/mol. Its IUPAC name is N-[1-[2-(2,5-dimethoxy-4-methylsulfanylphenyl)ethyl]piperidin-4-yl]-N-phenylpropanamide.
Molecular Properties
| Compound Name | N-[1-[2-(2,5-dimethoxy-4-methylsulfanylphenyl)ethyl]piperidin-4-yl]-N-phenylpropanamide |
| PubChem CID | 165365067 |
| Molecular Formula | C25H34N2O3S |
| Molecular Weight | 442.63 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | N-[1-[2-(2,5-dimethoxy-4-methylsulfanylphenyl)ethyl]piperidin-4-yl]-N-phenylpropanamide |
| SMILES | CCC(=O)N(c1ccccc1)C1CCN(CCc2cc(OC)c(SC)cc2OC)CC1 |
| InChI | InChI=1S/C25H34N2O3S/c1-5-25(28)27(20-9-7-6-8-10-20)21-12-15-26(16-13-21)14-11-19-17-23(30-3)24(31-4)18-22(19)29-2/h6-10,17-18,21H,5,11-16H2,1-4H3 |
| InChIKey | NYGUILYQUWYLKO-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.63 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[1-[2-(2,5-dimethoxy-4-methylsulfanylphenyl)ethyl]piperidin-4-yl]-N-phenylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[2-(2,5-dimethoxy-4-methylsulfanylphenyl)ethyl]piperidin-4-yl]-N-phenylpropanamide?
The IUPAC name of N-[1-[2-(2,5-dimethoxy-4-methylsulfanylphenyl)ethyl]piperidin-4-yl]-N-phenylpropanamide (CID 165365067) is N-[1-[2-(2,5-dimethoxy-4-methylsulfanylphenyl)ethyl]piperidin-4-yl]-N-phenylpropanamide.
What is the SMILES notation for N-[1-[2-(2,5-dimethoxy-4-methylsulfanylphenyl)ethyl]piperidin-4-yl]-N-phenylpropanamide?
The canonical SMILES for N-[1-[2-(2,5-dimethoxy-4-methylsulfanylphenyl)ethyl]piperidin-4-yl]-N-phenylpropanamide is CCC(=O)N(c1ccccc1)C1CCN(CCc2cc(OC)c(SC)cc2OC)CC1.
What is the InChIKey of N-[1-[2-(2,5-dimethoxy-4-methylsulfanylphenyl)ethyl]piperidin-4-yl]-N-phenylpropanamide?
The InChIKey is NYGUILYQUWYLKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H34N2O3S/c1-5-25(28)27(20-9-7-6-8-10-20)21-12-15-26(16-13-21)14-11-19-17-23(30-3)24(31-4)18-22(19)29-2/h6-10,17-18,21H,5,11-16H2,1-4H3.
What are the key properties of N-[1-[2-(2,5-dimethoxy-4-methylsulfanylphenyl)ethyl]piperidin-4-yl]-N-phenylpropanamide?
N-[1-[2-(2,5-dimethoxy-4-methylsulfanylphenyl)ethyl]piperidin-4-yl]-N-phenylpropanamide has a molecular weight of 442.63 g/mol, XLogP of 4.88, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[2-(2,5-dimethoxy-4-methylsulfanylphenyl)ethyl]piperidin-4-yl]-N-phenylpropanamide is sourced from PubChem (CID 165365067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).