C18H26N2O3 — CID 174664510
[[3-[(4-hydroxypiperidin-1-yl)methyl]cyclobutyl]-phenylmethyl] carbamate (PubChem CID 174664510) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is [[3-[(4-hydroxypiperidin-1-yl)methyl]cyclobutyl]-phenylmethyl] carbamate.
| Compound Name | [[3-[(4-hydroxypiperidin-1-yl)methyl]cyclobutyl]-phenylmethyl] carbamate |
|---|---|
| PubChem CID | 174664510 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | [[3-[(4-hydroxypiperidin-1-yl)methyl]cyclobutyl]-phenylmethyl] carbamate |
| SMILES | NC(=O)OC(c1ccccc1)C1CC(CN2CCC(O)CC2)C1 |
| InChI | InChI=1S/C18H26N2O3/c19-18(22)23-17(14-4-2-1-3-5-14)15-10-13(11-15)12-20-8-6-16(21)7-9-20/h1-5,13,15-17,21H,6-12H2,(H2,19,22) |
| InChIKey | VMVGBIZTRODIAU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |